C25H32N4O4 — CID 123956534
benzyl N-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]carbamate (PubChem CID 123956534) has the molecular formula C25H32N4O4 and a molecular weight of 452.56 g/mol. Its IUPAC name is benzyl N-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123956534 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | benzyl N-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]carbamate |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1N(c1ccc([N+](=O)[O-])cc1)[C@H]1CCCNC1)OCc1ccccc1 |
| InChI | InChI=1S/C25H32N4O4/c30-25(33-18-19-7-2-1-3-8-19)27-23-10-4-5-11-24(23)28(22-9-6-16-26-17-22)20-12-14-21(15-13-20)29(31)32/h1-3,7-8,12-15,22-24,26H,4-6,9-11,16-18H2,(H,27,30)/t22-,23+,24+/m0/s1 |
| InChIKey | AIGVYGNGPWLHGF-RBZQAINGSA-N |
| XLogP | 4.39 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|