C24H31N5O3 — CID 123540900
1-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]-3-phenylurea (PubChem CID 123540900) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]-3-phenylurea.
| Compound Name | 1-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]-3-phenylurea |
|---|---|
| PubChem CID | 123540900 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 1-[(1R,2R)-2-(4-nitro-N-[(3S)-piperidin-3-yl]anilino)cyclohexyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N[C@@H]1CCCC[C@H]1N(c1ccc([N+](=O)[O-])cc1)[C@H]1CCCNC1 |
| InChI | InChI=1S/C24H31N5O3/c30-24(26-18-7-2-1-3-8-18)27-22-10-4-5-11-23(22)28(21-9-6-16-25-17-21)19-12-14-20(15-13-19)29(31)32/h1-3,7-8,12-15,21-23,25H,4-6,9-11,16-17H2,(H2,26,27,30)/t21-,22+,23+/m0/s1 |
| InChIKey | ADTYDLUFUXUDHJ-YTFSRNRJSA-N |
| XLogP | 4.29 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|