About 3-methylpiperidine;4-nitrobenzoic acid
3-methylpiperidine;4-nitrobenzoic acid (PubChem CID 153399011) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-methylpiperidine;4-nitrobenzoic acid.
Molecular Properties
| Compound Name | 3-methylpiperidine;4-nitrobenzoic acid |
| PubChem CID | 153399011 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-methylpiperidine;4-nitrobenzoic acid |
| SMILES | CC1CCCNC1.O=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H5NO4.C6H13N/c9-7(10)5-1-3-6(4-2-5)8(11)12;1-6-3-2-4-7-5-6/h1-4H,(H,9,10);6-7H,2-5H2,1H3 |
| InChIKey | SBZDGBVLGGDFDF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpiperidine;4-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpiperidine;4-nitrobenzoic acid?
The IUPAC name of 3-methylpiperidine;4-nitrobenzoic acid (CID 153399011) is 3-methylpiperidine;4-nitrobenzoic acid.
What is the SMILES notation for 3-methylpiperidine;4-nitrobenzoic acid?
The canonical SMILES for 3-methylpiperidine;4-nitrobenzoic acid is CC1CCCNC1.O=C(O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3-methylpiperidine;4-nitrobenzoic acid?
The InChIKey is SBZDGBVLGGDFDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.C6H13N/c9-7(10)5-1-3-6(4-2-5)8(11)12;1-6-3-2-4-7-5-6/h1-4H,(H,9,10);6-7H,2-5H2,1H3.
What are the key properties of 3-methylpiperidine;4-nitrobenzoic acid?
3-methylpiperidine;4-nitrobenzoic acid has a molecular weight of 266.30 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpiperidine;4-nitrobenzoic acid is sourced from PubChem (CID 153399011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).