C20H29ClN4O4 — CID 119799618
1-[4-(4-nitrobenzoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride (PubChem CID 119799618) has the molecular formula C20H29ClN4O4 and a molecular weight of 424.93 g/mol. Its IUPAC name is 1-[4-(4-nitrobenzoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride.
| Compound Name | 1-[4-(4-nitrobenzoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119799618 |
| Molecular Formula | C20H29ClN4O4 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[4-(4-nitrobenzoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride |
| SMILES | CC(CC(=O)N1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1)C1CCCNC1.Cl |
| InChI | InChI=1S/C20H28N4O4.ClH/c1-15(17-3-2-8-21-14-17)13-19(25)22-9-11-23(12-10-22)20(26)16-4-6-18(7-5-16)24(27)28;/h4-7,15,17,21H,2-3,8-14H2,1H3;1H |
| InChIKey | XFQBFCAZZIBLOD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|