C17H24ClN3O3 — CID 119699455
1-(6-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one;hydrochloride (PubChem CID 119699455) has the molecular formula C17H24ClN3O3 and a molecular weight of 353.85 g/mol. Its IUPAC name is 1-(6-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one;hydrochloride.
| Compound Name | 1-(6-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119699455 |
| Molecular Formula | C17H24ClN3O3 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-(6-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one;hydrochloride |
| SMILES | CC(CC(=O)N1CCc2ccc([N+](=O)[O-])cc21)C1CCCNC1.Cl |
| InChI | InChI=1S/C17H23N3O3.ClH/c1-12(14-3-2-7-18-11-14)9-17(21)19-8-6-13-4-5-15(20(22)23)10-16(13)19;/h4-5,10,12,14,18H,2-3,6-9,11H2,1H3;1H |
| InChIKey | LIPPITZVZVIJFC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|