C17H23N3O3 — CID 119788501
1-(4-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one (PubChem CID 119788501) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-(4-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one.
| Compound Name | 1-(4-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 119788501 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(4-nitro-2,3-dihydroindol-1-yl)-3-piperidin-3-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCc2c1cccc2[N+](=O)[O-])C1CCCNC1 |
| InChI | InChI=1S/C17H23N3O3/c1-12(13-4-3-8-18-11-13)10-17(21)19-9-7-14-15(19)5-2-6-16(14)20(22)23/h2,5-6,12-13,18H,3-4,7-11H2,1H3 |
| InChIKey | FAOHGJYWGPZONC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|