C21H33N3O — CID 119828393
1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one (PubChem CID 119828393) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 119828393 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one |
| SMILES | Cc1cccc(N2CCN(C(=O)CC(C)C3CCCNC3)CC2)c1C |
| InChI | InChI=1S/C21H33N3O/c1-16-6-4-8-20(18(16)3)23-10-12-24(13-11-23)21(25)14-17(2)19-7-5-9-22-15-19/h4,6,8,17,19,22H,5,7,9-15H2,1-3H3 |
| InChIKey | KZNFTRAUZJENOA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |