C21H33N3O — CID 119832584
1-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one (PubChem CID 119832584) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 1-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one.
| Compound Name | 1-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 119832584 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 1-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one |
| SMILES | Cc1ccccc1CN1CCN(C(=O)CC(C)C2CCCNC2)CC1 |
| InChI | InChI=1S/C21H33N3O/c1-17-6-3-4-7-20(17)16-23-10-12-24(13-11-23)21(25)14-18(2)19-8-5-9-22-15-19/h3-4,6-7,18-19,22H,5,8-16H2,1-2H3 |
| InChIKey | KLNYTRALXIXILD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |