C22H35N3O2 — CID 119838146
1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one (PubChem CID 119838146) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one.
| Compound Name | 1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 119838146 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]-3-piperidin-3-ylbutan-1-one |
| SMILES | CCOc1ccc(CN2CCN(C(=O)CC(C)C3CCCNC3)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O2/c1-3-27-21-8-6-19(7-9-21)17-24-11-13-25(14-12-24)22(26)15-18(2)20-5-4-10-23-16-20/h6-9,18,20,23H,3-5,10-17H2,1-2H3 |
| InChIKey | FXPOWSPXHNMGFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |