C21H31ClN2O2 — CID 119780448
1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-3-piperidin-3-ylbutan-1-one (PubChem CID 119780448) has the molecular formula C21H31ClN2O2 and a molecular weight of 378.94 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-3-piperidin-3-ylbutan-1-one.
| Compound Name | 1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-3-piperidin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 119780448 |
| Molecular Formula | C21H31ClN2O2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-3-piperidin-3-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCC(C(O)c2ccc(Cl)cc2)CC1)C1CCCNC1 |
| InChI | InChI=1S/C21H31ClN2O2/c1-15(18-3-2-10-23-14-18)13-20(25)24-11-8-17(9-12-24)21(26)16-4-6-19(22)7-5-16/h4-7,15,17-18,21,23,26H,2-3,8-14H2,1H3 |
| InChIKey | GIMPQJASJQSCKY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |