C16H31Cl2N3O — CID 119843625
1-(4-cyclopropylpiperazin-1-yl)-3-piperidin-3-ylbutan-1-one;dihydrochloride (PubChem CID 119843625) has the molecular formula C16H31Cl2N3O and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-(4-cyclopropylpiperazin-1-yl)-3-piperidin-3-ylbutan-1-one;dihydrochloride.
| Compound Name | 1-(4-cyclopropylpiperazin-1-yl)-3-piperidin-3-ylbutan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119843625 |
| Molecular Formula | C16H31Cl2N3O |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(4-cyclopropylpiperazin-1-yl)-3-piperidin-3-ylbutan-1-one;dihydrochloride |
| SMILES | CC(CC(=O)N1CCN(C2CC2)CC1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C16H29N3O.2ClH/c1-13(14-3-2-6-17-12-14)11-16(20)19-9-7-18(8-10-19)15-4-5-15;;/h13-15,17H,2-12H2,1H3;2*1H |
| InChIKey | ZFZXTPARKMPTDT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |