C17H33Cl2N3O — CID 119840395
N-(1-cyclopropylpiperidin-4-yl)-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119840395) has the molecular formula C17H33Cl2N3O and a molecular weight of 366.38 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119840395 |
| Molecular Formula | C17H33Cl2N3O |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NC1CCN(C2CC2)CC1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C17H31N3O.2ClH/c1-13(14-3-2-8-18-12-14)11-17(21)19-15-6-9-20(10-7-15)16-4-5-16;;/h13-16,18H,2-12H2,1H3,(H,19,21);2*1H |
| InChIKey | WONYMLYISQHWNY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |