C14H26N2O3S — CID 81044428
N-(1,1-dioxothian-4-yl)-3-piperidin-3-ylbutanamide (PubChem CID 81044428) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 81044428 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3-piperidin-3-ylbutanamide |
| SMILES | CC(CC(=O)NC1CCS(=O)(=O)CC1)C1CCCNC1 |
| InChI | InChI=1S/C14H26N2O3S/c1-11(12-3-2-6-15-10-12)9-14(17)16-13-4-7-20(18,19)8-5-13/h11-13,15H,2-10H2,1H3,(H,16,17) |
| InChIKey | FLFBOEYLUSBKHJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |