C17H35Cl2N3O — CID 119830098
N-[[1-(dimethylamino)cyclopentyl]methyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119830098) has the molecular formula C17H35Cl2N3O and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclopentyl]methyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[[1-(dimethylamino)cyclopentyl]methyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119830098 |
| Molecular Formula | C17H35Cl2N3O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | N-[[1-(dimethylamino)cyclopentyl]methyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCC1(N(C)C)CCCC1)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C17H33N3O.2ClH/c1-14(15-7-6-10-18-12-15)11-16(21)19-13-17(20(2)3)8-4-5-9-17;;/h14-15,18H,4-13H2,1-3H3,(H,19,21);2*1H |
| InChIKey | GVQXLEULMXXZBJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |