C21H38ClN3O2 — CID 119715757
1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride (PubChem CID 119715757) has the molecular formula C21H38ClN3O2 and a molecular weight of 400.01 g/mol. Its IUPAC name is 1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119715757 |
| Molecular Formula | C21H38ClN3O2 |
| Molecular Weight | 400.01 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 1-[4-(3-cyclopentylpropanoyl)piperazin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride |
| SMILES | CC(CC(=O)N1CCN(C(=O)CCC2CCCC2)CC1)C1CCCNC1.Cl |
| InChI | InChI=1S/C21H37N3O2.ClH/c1-17(19-7-4-10-22-16-19)15-21(26)24-13-11-23(12-14-24)20(25)9-8-18-5-2-3-6-18;/h17-19,22H,2-16H2,1H3;1H |
| InChIKey | YJVRXBKWQPYUIM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.01 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |