C21H30Cl2N2O2 — CID 119724457
1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride (PubChem CID 119724457) has the molecular formula C21H30Cl2N2O2 and a molecular weight of 413.39 g/mol. Its IUPAC name is 1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride.
| Compound Name | 1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119724457 |
| Molecular Formula | C21H30Cl2N2O2 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[4-(4-chlorobenzoyl)piperidin-1-yl]-3-piperidin-3-ylbutan-1-one;hydrochloride |
| SMILES | CC(CC(=O)N1CCC(C(=O)c2ccc(Cl)cc2)CC1)C1CCCNC1.Cl |
| InChI | InChI=1S/C21H29ClN2O2.ClH/c1-15(18-3-2-10-23-14-18)13-20(25)24-11-8-17(9-12-24)21(26)16-4-6-19(22)7-5-16;/h4-7,15,17-18,23H,2-3,8-14H2,1H3;1H |
| InChIKey | ADUINXUKGZEMJS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |