C11H14ClN3O3 — CID 119326470
(2S)-2-amino-1-(4-nitro-2,3-dihydroindol-1-yl)propan-1-one;hydrochloride (PubChem CID 119326470) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is (2S)-2-amino-1-(4-nitro-2,3-dihydroindol-1-yl)propan-1-one;hydrochloride.
| Compound Name | (2S)-2-amino-1-(4-nitro-2,3-dihydroindol-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119326470 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (2S)-2-amino-1-(4-nitro-2,3-dihydroindol-1-yl)propan-1-one;hydrochloride |
| SMILES | C[C@H](N)C(=O)N1CCc2c1cccc2[N+](=O)[O-].Cl |
| InChI | InChI=1S/C11H13N3O3.ClH/c1-7(12)11(15)13-6-5-8-9(13)3-2-4-10(8)14(16)17;/h2-4,7H,5-6,12H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | BYSILYYSWGJVNR-FJXQXJEOSA-N |
| XLogP | 1.25 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|