C12H14N2O4 — CID 174469221
(4-nitro-2,3-dihydroindol-1-yl) butanoate (PubChem CID 174469221) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (4-nitro-2,3-dihydroindol-1-yl) butanoate.
| Compound Name | (4-nitro-2,3-dihydroindol-1-yl) butanoate |
|---|---|
| PubChem CID | 174469221 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (4-nitro-2,3-dihydroindol-1-yl) butanoate |
| SMILES | CCCC(=O)ON1CCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O4/c1-2-4-12(15)18-13-8-7-9-10(13)5-3-6-11(9)14(16)17/h3,5-6H,2,4,7-8H2,1H3 |
| InChIKey | AGKNBPNDUADFJS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|