C17H20N4O3 — CID 71919047
(3,5-dimethyl-1-propylpyrazol-4-yl)-(4-nitro-2,3-dihydroindol-1-yl)methanone (PubChem CID 71919047) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (3,5-dimethyl-1-propylpyrazol-4-yl)-(4-nitro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3,5-dimethyl-1-propylpyrazol-4-yl)-(4-nitro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 71919047 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3,5-dimethyl-1-propylpyrazol-4-yl)-(4-nitro-2,3-dihydroindol-1-yl)methanone |
| SMILES | CCCn1nc(C)c(C(=O)N2CCc3c2cccc3[N+](=O)[O-])c1C |
| InChI | InChI=1S/C17H20N4O3/c1-4-9-20-12(3)16(11(2)18-20)17(22)19-10-8-13-14(19)6-5-7-15(13)21(23)24/h5-7H,4,8-10H2,1-3H3 |
| InChIKey | XBMZOPJEWHTAFD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|