C15H18N2O4 — CID 97326598
[(2S,5R)-5-methyloxolan-2-yl]-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 97326598) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is [(2S,5R)-5-methyloxolan-2-yl]-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | [(2S,5R)-5-methyloxolan-2-yl]-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 97326598 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(2S,5R)-5-methyloxolan-2-yl]-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | C[C@@H]1CC[C@@H](C(=O)N2CCCc3c2cccc3[N+](=O)[O-])O1 |
| InChI | InChI=1S/C15H18N2O4/c1-10-7-8-14(21-10)15(18)16-9-3-4-11-12(16)5-2-6-13(11)17(19)20/h2,5-6,10,14H,3-4,7-9H2,1H3/t10-,14+/m1/s1 |
| InChIKey | VVVNLJKMDDQADC-YGRLFVJLSA-N |
| XLogP | 2.44 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|