C14H11ClN2O4 — CID 84589440
(5-chlorofuran-2-yl)-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone (PubChem CID 84589440) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone.
| Compound Name | (5-chlorofuran-2-yl)-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 84589440 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (5-chlorofuran-2-yl)-(5-nitro-3,4-dihydro-2H-quinolin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cl)o1)N1CCCc2c1cccc2[N+](=O)[O-] |
| InChI | InChI=1S/C14H11ClN2O4/c15-13-7-6-12(21-13)14(18)16-8-2-3-9-10(16)4-1-5-11(9)17(19)20/h1,4-7H,2-3,8H2 |
| InChIKey | NKGJRLWONASFIM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|