C16H15NO3 — CID 114336564
1-(5-methylfuran-2-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 114336564) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(5-methylfuran-2-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 1-(5-methylfuran-2-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 114336564 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-(5-methylfuran-2-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | Cc1ccc(C(=O)N2CCCC(=O)c3ccccc32)o1 |
| InChI | InChI=1S/C16H15NO3/c1-11-8-9-15(20-11)16(19)17-10-4-7-14(18)12-5-2-3-6-13(12)17/h2-3,5-6,8-9H,4,7,10H2,1H3 |
| InChIKey | LDIQMFXFXMUHFP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |