C14H12N2O3 — CID 114336592
1-(1,2-oxazole-3-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 114336592) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-(1,2-oxazole-3-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 1-(1,2-oxazole-3-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 114336592 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-(1,2-oxazole-3-carbonyl)-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | O=C1CCCN(C(=O)c2ccon2)c2ccccc21 |
| InChI | InChI=1S/C14H12N2O3/c17-13-6-3-8-16(12-5-2-1-4-10(12)13)14(18)11-7-9-19-15-11/h1-2,4-5,7,9H,3,6,8H2 |
| InChIKey | WVMDRHHMIQLYDZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |