C17H21NO2 — CID 114336606
1-(2-cyclopentylacetyl)-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 114336606) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-(2-cyclopentylacetyl)-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 1-(2-cyclopentylacetyl)-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 114336606 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-(2-cyclopentylacetyl)-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | O=C1CCCN(C(=O)CC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C17H21NO2/c19-16-10-5-11-18(15-9-4-3-8-14(15)16)17(20)12-13-6-1-2-7-13/h3-4,8-9,13H,1-2,5-7,10-12H2 |
| InChIKey | SYYQGMRIBABTAD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |