C17H24N2O — CID 82707005
1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-cyclohexylethanone (PubChem CID 82707005) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-cyclohexylethanone.
| Compound Name | 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-cyclohexylethanone |
|---|---|
| PubChem CID | 82707005 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-(5-amino-3,4-dihydro-2H-quinolin-1-yl)-2-cyclohexylethanone |
| SMILES | Nc1cccc2c1CCCN2C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O/c18-15-9-4-10-16-14(15)8-5-11-19(16)17(20)12-13-6-2-1-3-7-13/h4,9-10,13H,1-3,5-8,11-12,18H2 |
| InChIKey | TYCOVTIZGSVBQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|