C17H24N2O — CID 82706528
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone (PubChem CID 82706528) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone.
| Compound Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
|---|---|
| PubChem CID | 82706528 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(2,2,3,3-tetramethylcyclopropyl)methanone |
| SMILES | CC1(C)C(C(=O)N2CCCc3c(N)cccc32)C1(C)C |
| InChI | InChI=1S/C17H24N2O/c1-16(2)14(17(16,3)4)15(20)19-10-6-7-11-12(18)8-5-9-13(11)19/h5,8-9,14H,6-7,10,18H2,1-4H3 |
| InChIKey | MZGXKDICIVZRID-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|