About (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone (PubChem CID 82705671) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone.
Molecular Properties
| Compound Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone |
| PubChem CID | 82705671 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone |
| SMILES | Nc1cccc2c1CCCN2C(=O)C1CCCOC1 |
| InChI | InChI=1S/C15H20N2O2/c16-13-6-1-7-14-12(13)5-2-8-17(14)15(18)11-4-3-9-19-10-11/h1,6-7,11H,2-5,8-10,16H2 |
| InChIKey | MYZDQLGDXAZUCA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone?
The IUPAC name of (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone (CID 82705671) is (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone.
What is the SMILES notation for (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone?
The canonical SMILES for (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone is Nc1cccc2c1CCCN2C(=O)C1CCCOC1.
What is the InChIKey of (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone?
The InChIKey is MYZDQLGDXAZUCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c16-13-6-1-7-14-12(13)5-2-8-17(14)15(18)11-4-3-9-19-10-11/h1,6-7,11H,2-5,8-10,16H2.
What are the key properties of (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone?
(5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone has a molecular weight of 260.34 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-3,4-dihydro-2H-quinolin-1-yl)-(oxan-3-yl)methanone is sourced from PubChem (CID 82705671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).