C18H25NO — CID 2300886
3-cyclohexyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one (PubChem CID 2300886) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 3-cyclohexyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 2300886 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 3-cyclohexyl-1-(3,4-dihydro-2H-quinolin-1-yl)propan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H25NO/c20-18(13-12-15-7-2-1-3-8-15)19-14-6-10-16-9-4-5-11-17(16)19/h4-5,9,11,15H,1-3,6-8,10,12-14H2 |
| InChIKey | SEWZKLBQGYRCJF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |