C22H32BrNO — CID 82259604
1-[6-(2-bromo-2-methylpropyl)-3,4-dihydro-2H-quinolin-1-yl]-3-cyclohexylpropan-1-one (PubChem CID 82259604) has the molecular formula C22H32BrNO and a molecular weight of 406.41 g/mol. Its IUPAC name is 1-[6-(2-bromo-2-methylpropyl)-3,4-dihydro-2H-quinolin-1-yl]-3-cyclohexylpropan-1-one.
| Compound Name | 1-[6-(2-bromo-2-methylpropyl)-3,4-dihydro-2H-quinolin-1-yl]-3-cyclohexylpropan-1-one |
|---|---|
| PubChem CID | 82259604 |
| Molecular Formula | C22H32BrNO |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[6-(2-bromo-2-methylpropyl)-3,4-dihydro-2H-quinolin-1-yl]-3-cyclohexylpropan-1-one |
| SMILES | CC(C)(Br)Cc1ccc2c(c1)CCCN2C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C22H32BrNO/c1-22(2,23)16-18-10-12-20-19(15-18)9-6-14-24(20)21(25)13-11-17-7-4-3-5-8-17/h10,12,15,17H,3-9,11,13-14,16H2,1-2H3 |
| InChIKey | VCTOWUCRQJQWRT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|