C12H16N2O3 — CID 7210197
(2R,6R)-2,6-dimethyl-4-(2-nitrophenyl)morpholine (PubChem CID 7210197) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-(2-nitrophenyl)morpholine.
| Compound Name | (2R,6R)-2,6-dimethyl-4-(2-nitrophenyl)morpholine |
|---|---|
| PubChem CID | 7210197 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-(2-nitrophenyl)morpholine |
| SMILES | C[C@@H]1CN(c2ccccc2[N+](=O)[O-])C[C@@H](C)O1 |
| InChI | InChI=1S/C12H16N2O3/c1-9-7-13(8-10(2)17-9)11-5-3-4-6-12(11)14(15)16/h3-6,9-10H,7-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | ZZBYVKYAISMKDR-NXEZZACHSA-N |
| XLogP | 2.21 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|