C19H26N4O4 — CID 124863325
2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitrobenzonitrile (PubChem CID 124863325) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitrobenzonitrile.
| Compound Name | 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 124863325 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-5-nitrobenzonitrile |
| SMILES | C[C@@H]1CN(c2cc(N3C[C@@H](C)O[C@@H](C)C3)c([N+](=O)[O-])cc2C#N)C[C@@H](C)O1 |
| InChI | InChI=1S/C19H26N4O4/c1-12-8-21(9-13(2)26-12)17-6-18(19(23(24)25)5-16(17)7-20)22-10-14(3)27-15(4)11-22/h5-6,12-15H,8-11H2,1-4H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | RLHRZRZIDKWMDT-TUVASFSCSA-N |
| XLogP | 2.69 |
| TPSA | 91.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|