C13H13N5O2 — CID 4285583
4-(4-methylpiperazin-1-yl)-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 4285583) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-methylpiperazin-1-yl)-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 4285583 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | CN1CCN(c2cc(C#N)c(C#N)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H13N5O2/c1-16-2-4-17(5-3-16)12-6-10(8-14)11(9-15)7-13(12)18(19)20/h6-7H,2-5H2,1H3 |
| InChIKey | STRLPRVVGFONBP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 97.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|