C13H16N4O2 — CID 115500909
5-(4-methyl-1,4-diazepan-1-yl)-2-nitrobenzonitrile (PubChem CID 115500909) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(4-methyl-1,4-diazepan-1-yl)-2-nitrobenzonitrile.
| Compound Name | 5-(4-methyl-1,4-diazepan-1-yl)-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 115500909 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-(4-methyl-1,4-diazepan-1-yl)-2-nitrobenzonitrile |
| SMILES | CN1CCCN(c2ccc([N+](=O)[O-])c(C#N)c2)CC1 |
| InChI | InChI=1S/C13H16N4O2/c1-15-5-2-6-16(8-7-15)12-3-4-13(17(18)19)11(9-12)10-14/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | RKGNRCZXWLNOOS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|