C13H15N3O2 — CID 113324277
5-(3,3-dimethylpyrrolidin-1-yl)-2-nitrobenzonitrile (PubChem CID 113324277) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(3,3-dimethylpyrrolidin-1-yl)-2-nitrobenzonitrile.
| Compound Name | 5-(3,3-dimethylpyrrolidin-1-yl)-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 113324277 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 5-(3,3-dimethylpyrrolidin-1-yl)-2-nitrobenzonitrile |
| SMILES | CC1(C)CCN(c2ccc([N+](=O)[O-])c(C#N)c2)C1 |
| InChI | InChI=1S/C13H15N3O2/c1-13(2)5-6-15(9-13)11-3-4-12(16(17)18)10(7-11)8-14/h3-4,7H,5-6,9H2,1-2H3 |
| InChIKey | VKLYYFQHJKAYSO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|