C14H19ClN2O2 — CID 114057879
1-[3-(chloromethyl)-4-nitrophenyl]-3,3-dimethylpiperidine (PubChem CID 114057879) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-4-nitrophenyl]-3,3-dimethylpiperidine.
| Compound Name | 1-[3-(chloromethyl)-4-nitrophenyl]-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 114057879 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-[3-(chloromethyl)-4-nitrophenyl]-3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCN(c2ccc([N+](=O)[O-])c(CCl)c2)C1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-14(2)6-3-7-16(10-14)12-4-5-13(17(18)19)11(8-12)9-15/h4-5,8H,3,6-7,9-10H2,1-2H3 |
| InChIKey | CUFZRDYKKRRBDB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|