C12H15ClN2O3 — CID 114057867
4-[3-(chloromethyl)-4-nitrophenyl]-1,4-oxazepane (PubChem CID 114057867) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 4-[3-(chloromethyl)-4-nitrophenyl]-1,4-oxazepane.
| Compound Name | 4-[3-(chloromethyl)-4-nitrophenyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 114057867 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 4-[3-(chloromethyl)-4-nitrophenyl]-1,4-oxazepane |
| SMILES | O=[N+]([O-])c1ccc(N2CCCOCC2)cc1CCl |
| InChI | InChI=1S/C12H15ClN2O3/c13-9-10-8-11(2-3-12(10)15(16)17)14-4-1-6-18-7-5-14/h2-3,8H,1,4-7,9H2 |
| InChIKey | KRFZETCBBJMVIU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|