C12H12N4O4 — CID 107325343
3-amino-1-(3-cyano-4-nitrophenyl)pyrrolidine-3-carboxylic acid (PubChem CID 107325343) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-amino-1-(3-cyano-4-nitrophenyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(3-cyano-4-nitrophenyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107325343 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-amino-1-(3-cyano-4-nitrophenyl)pyrrolidine-3-carboxylic acid |
| SMILES | N#Cc1cc(N2CCC(N)(C(=O)O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O4/c13-6-8-5-9(1-2-10(8)16(19)20)15-4-3-12(14,7-15)11(17)18/h1-2,5H,3-4,7,14H2,(H,17,18) |
| InChIKey | ORDVEMXFNMMDQG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|