C15H16N4O2 — CID 40560319
4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 40560319) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 40560319 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(C#N)c(C#N)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H16N4O2/c1-10-3-11(2)9-18(8-10)14-4-12(6-16)13(7-17)5-15(14)19(20)21/h4-5,10-11H,3,8-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | QIPJLDIRSZAQEG-QWRGUYRKSA-N |
| XLogP | 2.82 |
| TPSA | 93.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|