C14H17N3O2 — CID 40560292
4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzonitrile (PubChem CID 40560292) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzonitrile.
| Compound Name | 4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 40560292 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzonitrile |
| SMILES | C[C@@H]1C[C@H](C)CN(c2ccc(C#N)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H17N3O2/c1-10-5-11(2)9-16(8-10)13-4-3-12(7-15)6-14(13)17(18)19/h3-4,6,10-11H,5,8-9H2,1-2H3/t10-,11+ |
| InChIKey | SNJSEVWIBFVQLE-PHIMTYICSA-N |
| XLogP | 2.95 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|