C19H20Br2FN3O4 — CID 159465334
4-bromo-1-fluoro-2-nitrobenzene;1-(4-bromo-2-nitrophenyl)-3,5-dimethylpiperidine (PubChem CID 159465334) has the molecular formula C19H20Br2FN3O4 and a molecular weight of 533.19 g/mol. Its IUPAC name is 4-bromo-1-fluoro-2-nitrobenzene;1-(4-bromo-2-nitrophenyl)-3,5-dimethylpiperidine.
| Compound Name | 4-bromo-1-fluoro-2-nitrobenzene;1-(4-bromo-2-nitrophenyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 159465334 |
| Molecular Formula | C19H20Br2FN3O4 |
| Molecular Weight | 533.19 g/mol |
| Exact Mass | 530.98 |
| IUPAC Name | 4-bromo-1-fluoro-2-nitrobenzene;1-(4-bromo-2-nitrophenyl)-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(c2ccc(Br)cc2[N+](=O)[O-])C1.O=[N+]([O-])c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H17BrN2O2.C6H3BrFNO2/c1-9-5-10(2)8-15(7-9)12-4-3-11(14)6-13(12)16(17)18;7-4-1-2-5(8)6(3-4)9(10)11/h3-4,6,9-10H,5,7-8H2,1-2H3;1-3H |
| InChIKey | LVCKPVIICZZYIQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.19 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|