5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid

C14H17FN2O4 — CID 104699587

IUPAC5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid
SMILESCC1CC(C)CN(c2cc(C(=O)O)c(F)cc2[N+](=O)[O-])C1
InChIInChI=1S/C14H17FN2O4/c1-8-3-9(2)7-16(6-8)12-4-10(14(18)19)11(15)5-13(12)17(20)21/h4-5,8-9H,3,6-7H2,1-2H3,(H,18,19)
InChIKeyQJLUURHJIMQWNA-UHFFFAOYSA-N
MW296.30 g/mol
LogP2.91
Rot. Bonds3

About 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid

5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid (PubChem CID 104699587) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid.

Molecular Properties

Compound Name5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid
PubChem CID104699587
Molecular FormulaC14H17FN2O4
Molecular Weight296.30 g/mol
Exact Mass296.12
IUPAC Name5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid
SMILESCC1CC(C)CN(c2cc(C(=O)O)c(F)cc2[N+](=O)[O-])C1
InChIInChI=1S/C14H17FN2O4/c1-8-3-9(2)7-16(6-8)12-4-10(14(18)19)11(15)5-13(12)17(20)21/h4-5,8-9H,3,6-7H2,1-2H3,(H,18,19)
InChIKeyQJLUURHJIMQWNA-UHFFFAOYSA-N
XLogP2.91
TPSA83.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.30
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid?
The IUPAC name of 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid (CID 104699587) is 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid.
What is the SMILES notation for 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid?
The canonical SMILES for 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid is CC1CC(C)CN(c2cc(C(=O)O)c(F)cc2[N+](=O)[O-])C1.
What is the InChIKey of 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid?
The InChIKey is QJLUURHJIMQWNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN2O4/c1-8-3-9(2)7-16(6-8)12-4-10(14(18)19)11(15)5-13(12)17(20)21/h4-5,8-9H,3,6-7H2,1-2H3,(H,18,19).
What are the key properties of 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid?
5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid has a molecular weight of 296.30 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethylpiperidin-1-yl)-2-fluoro-4-nitrobenzoic acid is sourced from PubChem (CID 104699587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).