C13H16FN3O4 — CID 104699617
2-fluoro-5-(4-methyl-1,4-diazepan-1-yl)-4-nitrobenzoic acid (PubChem CID 104699617) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is 2-fluoro-5-(4-methyl-1,4-diazepan-1-yl)-4-nitrobenzoic acid.
| Compound Name | 2-fluoro-5-(4-methyl-1,4-diazepan-1-yl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 104699617 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-fluoro-5-(4-methyl-1,4-diazepan-1-yl)-4-nitrobenzoic acid |
| SMILES | CN1CCCN(c2cc(C(=O)O)c(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H16FN3O4/c1-15-3-2-4-16(6-5-15)11-7-9(13(18)19)10(14)8-12(11)17(20)21/h7-8H,2-6H2,1H3,(H,18,19) |
| InChIKey | RPVHUJKETAOGBC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|