C12H13FN2O5S — CID 104699818
methyl 2-fluoro-4-nitro-5-(1-oxo-1,4-thiazinan-4-yl)benzoate (PubChem CID 104699818) has the molecular formula C12H13FN2O5S and a molecular weight of 316.31 g/mol. Its IUPAC name is methyl 2-fluoro-4-nitro-5-(1-oxo-1,4-thiazinan-4-yl)benzoate.
| Compound Name | methyl 2-fluoro-4-nitro-5-(1-oxo-1,4-thiazinan-4-yl)benzoate |
|---|---|
| PubChem CID | 104699818 |
| Molecular Formula | C12H13FN2O5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 2-fluoro-4-nitro-5-(1-oxo-1,4-thiazinan-4-yl)benzoate |
| SMILES | COC(=O)c1cc(N2CCS(=O)CC2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H13FN2O5S/c1-20-12(16)8-6-10(11(15(17)18)7-9(8)13)14-2-4-21(19)5-3-14/h6-7H,2-5H2,1H3 |
| InChIKey | FYVWUIINMRLZEV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|