C16H18FN3O5 — CID 162517365
methyl 2-fluoro-5-nitro-4-(3-oxo-2,8-diazaspiro[4.5]decan-8-yl)benzoate (PubChem CID 162517365) has the molecular formula C16H18FN3O5 and a molecular weight of 351.33 g/mol. Its IUPAC name is methyl 2-fluoro-5-nitro-4-(3-oxo-2,8-diazaspiro[4.5]decan-8-yl)benzoate.
| Compound Name | methyl 2-fluoro-5-nitro-4-(3-oxo-2,8-diazaspiro[4.5]decan-8-yl)benzoate |
|---|---|
| PubChem CID | 162517365 |
| Molecular Formula | C16H18FN3O5 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | methyl 2-fluoro-5-nitro-4-(3-oxo-2,8-diazaspiro[4.5]decan-8-yl)benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCC3(CC2)CNC(=O)C3)cc1F |
| InChI | InChI=1S/C16H18FN3O5/c1-25-15(22)10-6-13(20(23)24)12(7-11(10)17)19-4-2-16(3-5-19)8-14(21)18-9-16/h6-7H,2-5,8-9H2,1H3,(H,18,21) |
| InChIKey | WCEUJPOAEPDQTM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|