C19H19ClFN3O4 — CID 133394504
methyl 2-chloro-4-[4-(2-fluoroanilino)piperidin-1-yl]-5-nitrobenzoate (PubChem CID 133394504) has the molecular formula C19H19ClFN3O4 and a molecular weight of 407.83 g/mol. Its IUPAC name is methyl 2-chloro-4-[4-(2-fluoroanilino)piperidin-1-yl]-5-nitrobenzoate.
| Compound Name | methyl 2-chloro-4-[4-(2-fluoroanilino)piperidin-1-yl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 133394504 |
| Molecular Formula | C19H19ClFN3O4 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | methyl 2-chloro-4-[4-(2-fluoroanilino)piperidin-1-yl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCC(Nc3ccccc3F)CC2)cc1Cl |
| InChI | InChI=1S/C19H19ClFN3O4/c1-28-19(25)13-10-18(24(26)27)17(11-14(13)20)23-8-6-12(7-9-23)22-16-5-3-2-4-15(16)21/h2-5,10-12,22H,6-9H2,1H3 |
| InChIKey | AVDQYZKXPPEVJC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|