C14H11ClF6N2O4 — CID 133394020
methyl 4-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-2-chloro-5-nitrobenzoate (PubChem CID 133394020) has the molecular formula C14H11ClF6N2O4 and a molecular weight of 420.69 g/mol. Its IUPAC name is methyl 4-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-2-chloro-5-nitrobenzoate.
| Compound Name | methyl 4-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 133394020 |
| Molecular Formula | C14H11ClF6N2O4 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | methyl 4-[3,3-bis(trifluoromethyl)pyrrolidin-1-yl]-2-chloro-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCC(C(F)(F)F)(C(F)(F)F)C2)cc1Cl |
| InChI | InChI=1S/C14H11ClF6N2O4/c1-27-11(24)7-4-10(23(25)26)9(5-8(7)15)22-3-2-12(6-22,13(16,17)18)14(19,20)21/h4-5H,2-3,6H2,1H3 |
| InChIKey | JUYXQMISZCSFTC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|