C18H21ClN4O4 — CID 133388571
methyl 2-chloro-4-(1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-nitrobenzoate (PubChem CID 133388571) has the molecular formula C18H21ClN4O4 and a molecular weight of 392.84 g/mol. Its IUPAC name is methyl 2-chloro-4-(1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-nitrobenzoate.
| Compound Name | methyl 2-chloro-4-(1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 133388571 |
| Molecular Formula | C18H21ClN4O4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl 2-chloro-4-(1-methyl-2-propan-2-yl-6,7-dihydro-4H-imidazo[4,5-c]pyridin-5-yl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCc3c(nc(C(C)C)n3C)C2)cc1Cl |
| InChI | InChI=1S/C18H21ClN4O4/c1-10(2)17-20-13-9-22(6-5-14(13)21(17)3)15-8-12(19)11(18(24)27-4)7-16(15)23(25)26/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | OOSKAAWZKDKCHN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|