C18H24ClN3O5 — CID 133394172
methyl 2-chloro-5-nitro-4-[4-(oxan-4-yl)-1,4-diazepan-1-yl]benzoate (PubChem CID 133394172) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is methyl 2-chloro-5-nitro-4-[4-(oxan-4-yl)-1,4-diazepan-1-yl]benzoate.
| Compound Name | methyl 2-chloro-5-nitro-4-[4-(oxan-4-yl)-1,4-diazepan-1-yl]benzoate |
|---|---|
| PubChem CID | 133394172 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 2-chloro-5-nitro-4-[4-(oxan-4-yl)-1,4-diazepan-1-yl]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCCN(C3CCOCC3)CC2)cc1Cl |
| InChI | InChI=1S/C18H24ClN3O5/c1-26-18(23)14-11-17(22(24)25)16(12-15(14)19)21-6-2-5-20(7-8-21)13-3-9-27-10-4-13/h11-13H,2-10H2,1H3 |
| InChIKey | HKZMZZYWJNWHQG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|