C19H19ClN2O5 — CID 133394494
methyl 2-chloro-4-[2-(2-methylphenyl)morpholin-4-yl]-5-nitrobenzoate (PubChem CID 133394494) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is methyl 2-chloro-4-[2-(2-methylphenyl)morpholin-4-yl]-5-nitrobenzoate.
| Compound Name | methyl 2-chloro-4-[2-(2-methylphenyl)morpholin-4-yl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 133394494 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 2-chloro-4-[2-(2-methylphenyl)morpholin-4-yl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(N2CCOC(c3ccccc3C)C2)cc1Cl |
| InChI | InChI=1S/C19H19ClN2O5/c1-12-5-3-4-6-13(12)18-11-21(7-8-27-18)16-10-15(20)14(19(23)26-2)9-17(16)22(24)25/h3-6,9-10,18H,7-8,11H2,1-2H3 |
| InChIKey | UBDXRCTWIWKVKW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|