C12H11F3N2O4 — CID 170630233
methyl 5-(3,3-difluoropyrrolidin-1-yl)-4-fluoro-2-nitrobenzoate (PubChem CID 170630233) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is methyl 5-(3,3-difluoropyrrolidin-1-yl)-4-fluoro-2-nitrobenzoate.
| Compound Name | methyl 5-(3,3-difluoropyrrolidin-1-yl)-4-fluoro-2-nitrobenzoate |
|---|---|
| PubChem CID | 170630233 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | methyl 5-(3,3-difluoropyrrolidin-1-yl)-4-fluoro-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(N2CCC(F)(F)C2)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F3N2O4/c1-21-11(18)7-4-10(8(13)5-9(7)17(19)20)16-3-2-12(14,15)6-16/h4-5H,2-3,6H2,1H3 |
| InChIKey | ZVTONIDXLQTBGZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|